C24H27N5O3S — CID 16662808
N-(2-aminophenyl)-6-[4-(benzenesulfonyl)-3,3-dimethylpiperazin-1-yl]pyridine-3-carboxamide (PubChem CID 16662808) has the molecular formula C24H27N5O3S and a molecular weight of 465.58 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-[4-(benzenesulfonyl)-3,3-dimethylpiperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | N-(2-aminophenyl)-6-[4-(benzenesulfonyl)-3,3-dimethylpiperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 16662808 |
| Molecular Formula | C24H27N5O3S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | N-(2-aminophenyl)-6-[4-(benzenesulfonyl)-3,3-dimethylpiperazin-1-yl]pyridine-3-carboxamide |
| SMILES | CC1(C)CN(c2ccc(C(=O)Nc3ccccc3N)cn2)CCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H27N5O3S/c1-24(2)17-28(14-15-29(24)33(31,32)19-8-4-3-5-9-19)22-13-12-18(16-26-22)23(30)27-21-11-7-6-10-20(21)25/h3-13,16H,14-15,17,25H2,1-2H3,(H,27,30) |
| InChIKey | FRQWGCYGKCXMKM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|