C25H33N5O2S — CID 166628086
cyclopentyl-[4-[[3-[[(4E)-4-hydroxyimino-6,7-dihydro-5H-1,3-benzothiazol-2-yl]amino]-2-methylphenyl]methyl]piperazin-1-yl]methanone (PubChem CID 166628086) has the molecular formula C25H33N5O2S and a molecular weight of 467.64 g/mol. Its IUPAC name is cyclopentyl-[4-[[3-[[(4E)-4-hydroxyimino-6,7-dihydro-5H-1,3-benzothiazol-2-yl]amino]-2-methylphenyl]methyl]piperazin-1-yl]methanone.
| Compound Name | cyclopentyl-[4-[[3-[[(4E)-4-hydroxyimino-6,7-dihydro-5H-1,3-benzothiazol-2-yl]amino]-2-methylphenyl]methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 166628086 |
| Molecular Formula | C25H33N5O2S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | cyclopentyl-[4-[[3-[[(4E)-4-hydroxyimino-6,7-dihydro-5H-1,3-benzothiazol-2-yl]amino]-2-methylphenyl]methyl]piperazin-1-yl]methanone |
| SMILES | Cc1c(CN2CCN(C(=O)C3CCCC3)CC2)cccc1Nc1nc2c(s1)CCC/C2=N\O |
| InChI | InChI=1S/C25H33N5O2S/c1-17-19(16-29-12-14-30(15-13-29)24(31)18-6-2-3-7-18)8-4-9-20(17)26-25-27-23-21(28-32)10-5-11-22(23)33-25/h4,8-9,18,32H,2-3,5-7,10-16H2,1H3,(H,26,27)/b28-21+ |
| InChIKey | ICTVMUIVBRMGRN-SGWCAAJKSA-N |
| XLogP | 4.54 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|