C27H30F5N3 — CID 166628103
(1R,3R)-1-[4-(4,4-difluoropiperidin-1-yl)-2,6-difluorophenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 166628103) has the molecular formula C27H30F5N3 and a molecular weight of 491.55 g/mol. Its IUPAC name is (1R,3R)-1-[4-(4,4-difluoropiperidin-1-yl)-2,6-difluorophenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-[4-(4,4-difluoropiperidin-1-yl)-2,6-difluorophenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 166628103 |
| Molecular Formula | C27H30F5N3 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | (1R,3R)-1-[4-(4,4-difluoropiperidin-1-yl)-2,6-difluorophenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(N3CCC(F)(F)CC3)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C27H30F5N3/c1-16-12-19-18-6-4-5-7-22(18)33-24(19)25(35(16)15-26(2,3)30)23-20(28)13-17(14-21(23)29)34-10-8-27(31,32)9-11-34/h4-7,13-14,16,25,33H,8-12,15H2,1-3H3/t16-,25-/m1/s1 |
| InChIKey | OKXWJFWWRKAVIK-PUAOIOHZSA-N |
| XLogP | 6.77 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|