C24H24N2O5 — CID 166628163
12-[2-(dimethylamino)ethyl]-16,17-dimethoxy-6,8-dioxa-12-azapentacyclo[11.8.0.02,10.05,9.014,19]henicosa-1(13),2(10),3,5(9),14,16,18,20-octaen-11-one (PubChem CID 166628163) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is 12-[2-(dimethylamino)ethyl]-16,17-dimethoxy-6,8-dioxa-12-azapentacyclo[11.8.0.02,10.05,9.014,19]henicosa-1(13),2(10),3,5(9),14,16,18,20-octaen-11-one.
| Compound Name | 12-[2-(dimethylamino)ethyl]-16,17-dimethoxy-6,8-dioxa-12-azapentacyclo[11.8.0.02,10.05,9.014,19]henicosa-1(13),2(10),3,5(9),14,16,18,20-octaen-11-one |
|---|---|
| PubChem CID | 166628163 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 12-[2-(dimethylamino)ethyl]-16,17-dimethoxy-6,8-dioxa-12-azapentacyclo[11.8.0.02,10.05,9.014,19]henicosa-1(13),2(10),3,5(9),14,16,18,20-octaen-11-one |
| SMILES | COc1cc2ccc3c4ccc5c(c4c(=O)n(CCN(C)C)c3c2cc1OC)OCO5 |
| InChI | InChI=1S/C24H24N2O5/c1-25(2)9-10-26-22-16(6-5-14-11-19(28-3)20(29-4)12-17(14)22)15-7-8-18-23(31-13-30-18)21(15)24(26)27/h5-8,11-12H,9-10,13H2,1-4H3 |
| InChIKey | BDHCEUJILQSZKZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 62.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|