C20H22F2O3 — CID 166628197
6-[1-(3,4-difluorophenyl)ethenyl]spiro[1,2,4-trioxane-3,2'-adamantane] (PubChem CID 166628197) has the molecular formula C20H22F2O3 and a molecular weight of 348.39 g/mol. Its IUPAC name is 6-[1-(3,4-difluorophenyl)ethenyl]spiro[1,2,4-trioxane-3,2'-adamantane].
| Compound Name | 6-[1-(3,4-difluorophenyl)ethenyl]spiro[1,2,4-trioxane-3,2'-adamantane] |
|---|---|
| PubChem CID | 166628197 |
| Molecular Formula | C20H22F2O3 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 6-[1-(3,4-difluorophenyl)ethenyl]spiro[1,2,4-trioxane-3,2'-adamantane] |
| SMILES | C=C(c1ccc(F)c(F)c1)C1COC2(OO1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C20H22F2O3/c1-11(14-2-3-17(21)18(22)9-14)19-10-23-20(25-24-19)15-5-12-4-13(7-15)8-16(20)6-12/h2-3,9,12-13,15-16,19H,1,4-8,10H2 |
| InChIKey | BGSSSDJUSQYACL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|