About 2-(2,4-dimethoxyphenyl)-7-(3-methylbut-2-enoxy)-2,3-dihydrochromen-4-one
2-(2,4-dimethoxyphenyl)-7-(3-methylbut-2-enoxy)-2,3-dihydrochromen-4-one (PubChem CID 166628348) has the molecular formula C22H24O5
and a molecular weight of 368.43 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-7-(3-methylbut-2-enoxy)-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 2-(2,4-dimethoxyphenyl)-7-(3-methylbut-2-enoxy)-2,3-dihydrochromen-4-one |
| PubChem CID | 166628348 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-7-(3-methylbut-2-enoxy)-2,3-dihydrochromen-4-one |
| SMILES | COc1ccc(C2CC(=O)c3ccc(OCC=C(C)C)cc3O2)c(OC)c1 |
| InChI | InChI=1S/C22H24O5/c1-14(2)9-10-26-16-6-7-17-19(23)13-22(27-21(17)12-16)18-8-5-15(24-3)11-20(18)25-4/h5-9,11-12,22H,10,13H2,1-4H3 |
| InChIKey | KHVIKPIDTOJTHV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dimethoxyphenyl)-7-(3-methylbut-2-enoxy)-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethoxyphenyl)-7-(3-methylbut-2-enoxy)-2,3-dihydrochromen-4-one?
The IUPAC name of 2-(2,4-dimethoxyphenyl)-7-(3-methylbut-2-enoxy)-2,3-dihydrochromen-4-one (CID 166628348) is 2-(2,4-dimethoxyphenyl)-7-(3-methylbut-2-enoxy)-2,3-dihydrochromen-4-one.
What is the SMILES notation for 2-(2,4-dimethoxyphenyl)-7-(3-methylbut-2-enoxy)-2,3-dihydrochromen-4-one?
The canonical SMILES for 2-(2,4-dimethoxyphenyl)-7-(3-methylbut-2-enoxy)-2,3-dihydrochromen-4-one is COc1ccc(C2CC(=O)c3ccc(OCC=C(C)C)cc3O2)c(OC)c1.
What is the InChIKey of 2-(2,4-dimethoxyphenyl)-7-(3-methylbut-2-enoxy)-2,3-dihydrochromen-4-one?
The InChIKey is KHVIKPIDTOJTHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24O5/c1-14(2)9-10-26-16-6-7-17-19(23)13-22(27-21(17)12-16)18-8-5-15(24-3)11-20(18)25-4/h5-9,11-12,22H,10,13H2,1-4H3.
What are the key properties of 2-(2,4-dimethoxyphenyl)-7-(3-methylbut-2-enoxy)-2,3-dihydrochromen-4-one?
2-(2,4-dimethoxyphenyl)-7-(3-methylbut-2-enoxy)-2,3-dihydrochromen-4-one has a molecular weight of 368.43 g/mol, XLogP of 4.76, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethoxyphenyl)-7-(3-methylbut-2-enoxy)-2,3-dihydrochromen-4-one is sourced from PubChem (CID 166628348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).