C37H33IN2O9 — CID 166628407
4-[[(1R)-1-carboxy-5-[4-(4-iodophenyl)butanoylamino]pentyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 166628407) has the molecular formula C37H33IN2O9 and a molecular weight of 776.58 g/mol. Its IUPAC name is 4-[[(1R)-1-carboxy-5-[4-(4-iodophenyl)butanoylamino]pentyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 4-[[(1R)-1-carboxy-5-[4-(4-iodophenyl)butanoylamino]pentyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 166628407 |
| Molecular Formula | C37H33IN2O9 |
| Molecular Weight | 776.58 g/mol |
| Exact Mass | 776.12 |
| IUPAC Name | 4-[[(1R)-1-carboxy-5-[4-(4-iodophenyl)butanoylamino]pentyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | O=C(CCCc1ccc(I)cc1)NCCCC[C@@H](NC(=O)c1ccc(C(=O)O)c(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c1)C(=O)O |
| InChI | InChI=1S/C37H33IN2O9/c38-23-10-7-21(8-11-23)4-3-6-33(43)39-17-2-1-5-30(37(47)48)40-35(44)22-9-14-26(36(45)46)29(18-22)34-27-15-12-24(41)19-31(27)49-32-20-25(42)13-16-28(32)34/h7-16,18-20,30,41H,1-6,17H2,(H,39,43)(H,40,44)(H,45,46)(H,47,48)/t30-/m1/s1 |
| InChIKey | JEOCDMQSNMITJA-SSEXGKCCSA-N |
| XLogP | 6.07 |
| TPSA | 183.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.58 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|