C29H34N4O2 — CID 166628510
1-(3,5-dimethylphenyl)-3-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]urea (PubChem CID 166628510) has the molecular formula C29H34N4O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]urea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]urea |
|---|---|
| PubChem CID | 166628510 |
| Molecular Formula | C29H34N4O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]urea |
| SMILES | C=CC1CN2CCC1C[C@H]2[C@@H](NC(=O)Nc1cc(C)cc(C)c1)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C29H34N4O2/c1-5-20-17-33-11-9-21(20)15-27(33)28(32-29(34)31-22-13-18(2)12-19(3)14-22)24-8-10-30-26-7-6-23(35-4)16-25(24)26/h5-8,10,12-14,16,20-21,27-28H,1,9,11,15,17H2,2-4H3,(H2,31,32,34)/t20?,21?,27-,28-/m0/s1 |
| InChIKey | QDMRJMCQCUBYOG-CWWNYQFUSA-N |
| XLogP | 5.62 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|