C22H28N2O3S — CID 166628516
N-(1,3-dihydrothieno[3,4-c]furan-4-ylmethyl)-2-[(9R)-9-pyridin-2-yl-2,6-dioxaspiro[4.5]decan-9-yl]ethanamine (PubChem CID 166628516) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is N-(1,3-dihydrothieno[3,4-c]furan-4-ylmethyl)-2-[(9R)-9-pyridin-2-yl-2,6-dioxaspiro[4.5]decan-9-yl]ethanamine.
| Compound Name | N-(1,3-dihydrothieno[3,4-c]furan-4-ylmethyl)-2-[(9R)-9-pyridin-2-yl-2,6-dioxaspiro[4.5]decan-9-yl]ethanamine |
|---|---|
| PubChem CID | 166628516 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-(1,3-dihydrothieno[3,4-c]furan-4-ylmethyl)-2-[(9R)-9-pyridin-2-yl-2,6-dioxaspiro[4.5]decan-9-yl]ethanamine |
| SMILES | c1ccc([C@]2(CCNCc3scc4c3COC4)CCOC3(CCOC3)C2)nc1 |
| InChI | InChI=1S/C22H28N2O3S/c1-2-7-24-20(3-1)21(5-10-27-22(15-21)6-9-25-16-22)4-8-23-11-19-18-13-26-12-17(18)14-28-19/h1-3,7,14,23H,4-6,8-13,15-16H2/t21-,22?/m1/s1 |
| InChIKey | IAOYZHHVWNDKPQ-ZMFCMNQTSA-N |
| XLogP | 3.56 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|