C28H34F3N5O2 — CID 166628571
[8-[(1S,5R)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanone (PubChem CID 166628571) has the molecular formula C28H34F3N5O2 and a molecular weight of 529.61 g/mol. Its IUPAC name is [8-[(1S,5R)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanone.
| Compound Name | [8-[(1S,5R)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 166628571 |
| Molecular Formula | C28H34F3N5O2 |
| Molecular Weight | 529.61 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | [8-[(1S,5R)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanone |
| SMILES | COC1C[C@H]2CC[C@@H](C1)N2c1ccc2c(c1)N(C(=O)C1CCN(CC(F)(F)F)CC1)Cc1cccnc1N2 |
| InChI | InChI=1S/C28H34F3N5O2/c1-38-23-13-20-4-5-21(14-23)36(20)22-6-7-24-25(15-22)35(16-19-3-2-10-32-26(19)33-24)27(37)18-8-11-34(12-9-18)17-28(29,30)31/h2-3,6-7,10,15,18,20-21,23H,4-5,8-9,11-14,16-17H2,1H3,(H,32,33)/t20-,21+,23? |
| InChIKey | BMDJNAPPGWIZBB-TYABSZSSSA-N |
| XLogP | 5.09 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.61 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |