C16H20N8O2 — CID 166628816
8-[5-methyl-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 166628816) has the molecular formula C16H20N8O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is 8-[5-methyl-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[5-methyl-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 166628816 |
| Molecular Formula | C16H20N8O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 8-[5-methyl-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1cnc(Nc2cnn(C)c2)nc1N1CCC2(CC1)NC(=O)NC2=O |
| InChI | InChI=1S/C16H20N8O2/c1-10-7-17-14(19-11-8-18-23(2)9-11)20-12(10)24-5-3-16(4-6-24)13(25)21-15(26)22-16/h7-9H,3-6H2,1-2H3,(H,17,19,20)(H2,21,22,25,26) |
| InChIKey | CIROHYIOBWWCMQ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 117.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|