About (2R)-3-hydroxy-2-[[(2R,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]propanoic acid
(2R)-3-hydroxy-2-[[(2R,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]propanoic acid (PubChem CID 166628854) has the molecular formula C8H14N2O5
and a molecular weight of 218.21 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-[[(2R,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]propanoic acid.
Molecular Properties
| Compound Name | (2R)-3-hydroxy-2-[[(2R,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]propanoic acid |
| PubChem CID | 166628854 |
| Molecular Formula | C8H14N2O5 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (2R)-3-hydroxy-2-[[(2R,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)[C@@H](CO)NC(=O)[C@H]1C[C@@H](O)CN1 |
| InChI | InChI=1S/C8H14N2O5/c11-3-6(8(14)15)10-7(13)5-1-4(12)2-9-5/h4-6,9,11-12H,1-3H2,(H,10,13)(H,14,15)/t4-,5-,6-/m1/s1 |
| InChIKey | UVSBYUFDCGZIMR-HSUXUTPPSA-N |
| XLogP | -2.73 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-3-hydroxy-2-[[(2R,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-hydroxy-2-[[(2R,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]propanoic acid?
The IUPAC name of (2R)-3-hydroxy-2-[[(2R,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]propanoic acid (CID 166628854) is (2R)-3-hydroxy-2-[[(2R,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]propanoic acid.
What is the SMILES notation for (2R)-3-hydroxy-2-[[(2R,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]propanoic acid?
The canonical SMILES for (2R)-3-hydroxy-2-[[(2R,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]propanoic acid is O=C(O)[C@@H](CO)NC(=O)[C@H]1C[C@@H](O)CN1.
What is the InChIKey of (2R)-3-hydroxy-2-[[(2R,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]propanoic acid?
The InChIKey is UVSBYUFDCGZIMR-HSUXUTPPSA-N. The full InChI is InChI=1S/C8H14N2O5/c11-3-6(8(14)15)10-7(13)5-1-4(12)2-9-5/h4-6,9,11-12H,1-3H2,(H,10,13)(H,14,15)/t4-,5-,6-/m1/s1.
What are the key properties of (2R)-3-hydroxy-2-[[(2R,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]propanoic acid?
(2R)-3-hydroxy-2-[[(2R,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]propanoic acid has a molecular weight of 218.21 g/mol, XLogP of -2.73, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-hydroxy-2-[[(2R,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]propanoic acid is sourced from PubChem (CID 166628854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).