About N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]naphthalene-1-carboxamide
N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]naphthalene-1-carboxamide (PubChem CID 166628886) has the molecular formula C21H18N4O
and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]naphthalene-1-carboxamide.
Molecular Properties
| Compound Name | N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]naphthalene-1-carboxamide |
| PubChem CID | 166628886 |
| Molecular Formula | C21H18N4O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]naphthalene-1-carboxamide |
| SMILES | O=C(NC(Cn1cncn1)c1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H18N4O/c26-21(19-12-6-10-16-7-4-5-11-18(16)19)24-20(13-25-15-22-14-23-25)17-8-2-1-3-9-17/h1-12,14-15,20H,13H2,(H,24,26) |
| InChIKey | QGSVJJTWTMXKDZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]naphthalene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]naphthalene-1-carboxamide?
The IUPAC name of N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]naphthalene-1-carboxamide (CID 166628886) is N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]naphthalene-1-carboxamide.
What is the SMILES notation for N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]naphthalene-1-carboxamide?
The canonical SMILES for N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]naphthalene-1-carboxamide is O=C(NC(Cn1cncn1)c1ccccc1)c1cccc2ccccc12.
What is the InChIKey of N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]naphthalene-1-carboxamide?
The InChIKey is QGSVJJTWTMXKDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N4O/c26-21(19-12-6-10-16-7-4-5-11-18(16)19)24-20(13-25-15-22-14-23-25)17-8-2-1-3-9-17/h1-12,14-15,20H,13H2,(H,24,26).
What are the key properties of N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]naphthalene-1-carboxamide?
N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]naphthalene-1-carboxamide has a molecular weight of 342.40 g/mol, XLogP of 3.60, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]naphthalene-1-carboxamide is sourced from PubChem (CID 166628886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).