C26H35N7O4 — CID 166628905
1-[4-[5-[4-amino-3-(3,4,5-trimethoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 166628905) has the molecular formula C26H35N7O4 and a molecular weight of 509.61 g/mol. Its IUPAC name is 1-[4-[5-[4-amino-3-(3,4,5-trimethoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[5-[4-amino-3-(3,4,5-trimethoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166628905 |
| Molecular Formula | C26H35N7O4 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | 1-[4-[5-[4-amino-3-(3,4,5-trimethoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(CCCCCn2nc(-c3cc(OC)c(OC)c(OC)c3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C26H35N7O4/c1-5-21(34)32-13-11-31(12-14-32)9-7-6-8-10-33-26-22(25(27)28-17-29-26)23(30-33)18-15-19(35-2)24(37-4)20(16-18)36-3/h5,15-17H,1,6-14H2,2-4H3,(H2,27,28,29) |
| InChIKey | DIXPDBVWKBKXJG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|