C28H28N4O5 — CID 166628931
N-[5-[2-(3,5-dimethoxyphenyl)ethynyl]-4-propan-2-yloxy-2-pyridinyl]-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 166628931) has the molecular formula C28H28N4O5 and a molecular weight of 500.56 g/mol. Its IUPAC name is N-[5-[2-(3,5-dimethoxyphenyl)ethynyl]-4-propan-2-yloxy-2-pyridinyl]-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | N-[5-[2-(3,5-dimethoxyphenyl)ethynyl]-4-propan-2-yloxy-2-pyridinyl]-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 166628931 |
| Molecular Formula | C28H28N4O5 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | N-[5-[2-(3,5-dimethoxyphenyl)ethynyl]-4-propan-2-yloxy-2-pyridinyl]-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | COc1cc(C#Cc2cnc(NC(=O)N3CCCc4ccc(C=O)nc43)cc2OC(C)C)cc(OC)c1 |
| InChI | InChI=1S/C28H28N4O5/c1-18(2)37-25-15-26(29-16-21(25)8-7-19-12-23(35-3)14-24(13-19)36-4)31-28(34)32-11-5-6-20-9-10-22(17-33)30-27(20)32/h9-10,12-18H,5-6,11H2,1-4H3,(H,29,31,34) |
| InChIKey | AMOYYRHLJSUOQD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|