C23H28N6O2S — CID 166629021
1-[[6-[[4-(3-hydroxypropylamino)-6-methylquinazolin-2-yl]amino]-1,3-benzothiazol-2-yl]amino]-2-methylpropan-2-ol (PubChem CID 166629021) has the molecular formula C23H28N6O2S and a molecular weight of 452.58 g/mol. Its IUPAC name is 1-[[6-[[4-(3-hydroxypropylamino)-6-methylquinazolin-2-yl]amino]-1,3-benzothiazol-2-yl]amino]-2-methylpropan-2-ol.
| Compound Name | 1-[[6-[[4-(3-hydroxypropylamino)-6-methylquinazolin-2-yl]amino]-1,3-benzothiazol-2-yl]amino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 166629021 |
| Molecular Formula | C23H28N6O2S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 1-[[6-[[4-(3-hydroxypropylamino)-6-methylquinazolin-2-yl]amino]-1,3-benzothiazol-2-yl]amino]-2-methylpropan-2-ol |
| SMILES | Cc1ccc2nc(Nc3ccc4nc(NCC(C)(C)O)sc4c3)nc(NCCCO)c2c1 |
| InChI | InChI=1S/C23H28N6O2S/c1-14-5-7-17-16(11-14)20(24-9-4-10-30)29-21(27-17)26-15-6-8-18-19(12-15)32-22(28-18)25-13-23(2,3)31/h5-8,11-12,30-31H,4,9-10,13H2,1-3H3,(H,25,28)(H2,24,26,27,29) |
| InChIKey | QFOFMBBCHWJSKO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|