C22H26N8O4 — CID 166629234
6-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenoxy]-N-hydroxyhexanamide (PubChem CID 166629234) has the molecular formula C22H26N8O4 and a molecular weight of 466.50 g/mol. Its IUPAC name is 6-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenoxy]-N-hydroxyhexanamide.
| Compound Name | 6-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenoxy]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 166629234 |
| Molecular Formula | C22H26N8O4 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 6-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenoxy]-N-hydroxyhexanamide |
| SMILES | Nc1nc(NCCc2ccc(OCCCCCC(=O)NO)cc2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C22H26N8O4/c23-20-26-21(27-22-25-19(28-30(20)22)17-5-4-14-34-17)24-12-11-15-7-9-16(10-8-15)33-13-3-1-2-6-18(31)29-32/h4-5,7-10,14,32H,1-3,6,11-13H2,(H,29,31)(H3,23,24,25,26,27,28) |
| InChIKey | REJIPFWBCXKIMB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 165.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|