C29H31N7 — CID 166629241
5,10-bis(4-methylpiperazin-1-yl)-15,18,22-triazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),3,5,8(13),9,11,14,16(21),17,19-undecaene (PubChem CID 166629241) has the molecular formula C29H31N7 and a molecular weight of 477.62 g/mol. Its IUPAC name is 5,10-bis(4-methylpiperazin-1-yl)-15,18,22-triazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),3,5,8(13),9,11,14,16(21),17,19-undecaene.
| Compound Name | 5,10-bis(4-methylpiperazin-1-yl)-15,18,22-triazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),3,5,8(13),9,11,14,16(21),17,19-undecaene |
|---|---|
| PubChem CID | 166629241 |
| Molecular Formula | C29H31N7 |
| Molecular Weight | 477.62 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | 5,10-bis(4-methylpiperazin-1-yl)-15,18,22-triazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),3,5,8(13),9,11,14,16(21),17,19-undecaene |
| SMILES | CN1CCN(c2ccc3c(c2)c2cc(N4CCN(C)CC4)ccc2c2nc4cnccc4nc32)CC1 |
| InChI | InChI=1S/C29H31N7/c1-33-9-13-35(14-10-33)20-3-5-22-24(17-20)25-18-21(36-15-11-34(2)12-16-36)4-6-23(25)29-28(22)31-26-7-8-30-19-27(26)32-29/h3-8,17-19H,9-16H2,1-2H3 |
| InChIKey | WJWPHCJLMYVPSX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 51.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.62 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|