C19H24FN3O3 — CID 166629313
N-[(4-fluorophenyl)methyl]-3-oxospiro[5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-1,1'-cyclohexane]-7-carboxamide (PubChem CID 166629313) has the molecular formula C19H24FN3O3 and a molecular weight of 361.42 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-oxospiro[5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-1,1'-cyclohexane]-7-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-oxospiro[5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-1,1'-cyclohexane]-7-carboxamide |
|---|---|
| PubChem CID | 166629313 |
| Molecular Formula | C19H24FN3O3 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-oxospiro[5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-1,1'-cyclohexane]-7-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)N1CCN2C(=O)OC3(CCCCC3)C2C1 |
| InChI | InChI=1S/C19H24FN3O3/c20-15-6-4-14(5-7-15)12-21-17(24)22-10-11-23-16(13-22)19(26-18(23)25)8-2-1-3-9-19/h4-7,16H,1-3,8-13H2,(H,21,24) |
| InChIKey | CZUSBFCKVCTNEP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |