About 2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]terephthalic acid
2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]terephthalic acid (PubChem CID 166629341) has the molecular formula C17H20N4O4
and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]terephthalic acid.
Molecular Properties
| Compound Name | 2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]terephthalic acid |
| PubChem CID | 166629341 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]terephthalic acid |
| SMILES | Cc1n[nH]c(C)c1N1CCN(c2cc(C(=O)O)ccc2C(=O)O)CC1 |
| InChI | InChI=1S/C17H20N4O4/c1-10-15(11(2)19-18-10)21-7-5-20(6-8-21)14-9-12(16(22)23)3-4-13(14)17(24)25/h3-4,9H,5-8H2,1-2H3,(H,18,19)(H,22,23)(H,24,25) |
| InChIKey | UZMNDEOJPFAYHS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]terephthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]terephthalic acid?
The IUPAC name of 2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]terephthalic acid (CID 166629341) is 2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]terephthalic acid.
What is the SMILES notation for 2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]terephthalic acid?
The canonical SMILES for 2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]terephthalic acid is Cc1n[nH]c(C)c1N1CCN(c2cc(C(=O)O)ccc2C(=O)O)CC1.
What is the InChIKey of 2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]terephthalic acid?
The InChIKey is UZMNDEOJPFAYHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4O4/c1-10-15(11(2)19-18-10)21-7-5-20(6-8-21)14-9-12(16(22)23)3-4-13(14)17(24)25/h3-4,9H,5-8H2,1-2H3,(H,18,19)(H,22,23)(H,24,25).
What are the key properties of 2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]terephthalic acid?
2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]terephthalic acid has a molecular weight of 344.37 g/mol, XLogP of 1.75, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]terephthalic acid is sourced from PubChem (CID 166629341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).