C26H31N3O3 — CID 166629343
[(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-(4-acetamido-2-pyridinyl)benzoate (PubChem CID 166629343) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is [(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-(4-acetamido-2-pyridinyl)benzoate.
| Compound Name | [(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-(4-acetamido-2-pyridinyl)benzoate |
|---|---|
| PubChem CID | 166629343 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | [(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-(4-acetamido-2-pyridinyl)benzoate |
| SMILES | C=C1[C@@H]2CCC[C@@]1(COC(=O)c1ccccc1-c1cc(NC(C)=O)ccn1)CN(CC)C2 |
| InChI | InChI=1S/C26H31N3O3/c1-4-29-15-20-8-7-12-26(16-29,18(20)2)17-32-25(31)23-10-6-5-9-22(23)24-14-21(11-13-27-24)28-19(3)30/h5-6,9-11,13-14,20H,2,4,7-8,12,15-17H2,1,3H3,(H,27,28,30)/t20-,26+/m1/s1 |
| InChIKey | NVUJORRYNGEGEI-IBVKSMDESA-N |
| XLogP | 4.54 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|