C25H32N8O2 — CID 166629438
N-[4-[4-amino-1-[5-(4-prop-2-enoylpiperazin-1-yl)pentyl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]acetamide (PubChem CID 166629438) has the molecular formula C25H32N8O2 and a molecular weight of 476.59 g/mol. Its IUPAC name is N-[4-[4-amino-1-[5-(4-prop-2-enoylpiperazin-1-yl)pentyl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[4-amino-1-[5-(4-prop-2-enoylpiperazin-1-yl)pentyl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 166629438 |
| Molecular Formula | C25H32N8O2 |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | N-[4-[4-amino-1-[5-(4-prop-2-enoylpiperazin-1-yl)pentyl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]acetamide |
| SMILES | C=CC(=O)N1CCN(CCCCCn2nc(-c3ccc(NC(C)=O)cc3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C25H32N8O2/c1-3-21(35)32-15-13-31(14-16-32)11-5-4-6-12-33-25-22(24(26)27-17-28-25)23(30-33)19-7-9-20(10-8-19)29-18(2)34/h3,7-10,17H,1,4-6,11-16H2,2H3,(H,29,34)(H2,26,27,28) |
| InChIKey | WADZNTABOSPWAL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|