C16H25N3O7S — CID 166629497
N-[[(2R,3S,4R,5R,6R)-5-amino-3,4-dihydroxy-6-propoxyoxan-2-yl]methyl]-4-sulfamoylbenzamide (PubChem CID 166629497) has the molecular formula C16H25N3O7S and a molecular weight of 403.46 g/mol. Its IUPAC name is N-[[(2R,3S,4R,5R,6R)-5-amino-3,4-dihydroxy-6-propoxyoxan-2-yl]methyl]-4-sulfamoylbenzamide.
| Compound Name | N-[[(2R,3S,4R,5R,6R)-5-amino-3,4-dihydroxy-6-propoxyoxan-2-yl]methyl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 166629497 |
| Molecular Formula | C16H25N3O7S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-[[(2R,3S,4R,5R,6R)-5-amino-3,4-dihydroxy-6-propoxyoxan-2-yl]methyl]-4-sulfamoylbenzamide |
| SMILES | CCCO[C@@H]1O[C@H](CNC(=O)c2ccc(S(N)(=O)=O)cc2)[C@@H](O)[C@H](O)[C@H]1N |
| InChI | InChI=1S/C16H25N3O7S/c1-2-7-25-16-12(17)14(21)13(20)11(26-16)8-19-15(22)9-3-5-10(6-4-9)27(18,23)24/h3-6,11-14,16,20-21H,2,7-8,17H2,1H3,(H,19,22)(H2,18,23,24)/t11-,12-,13-,14-,16-/m1/s1 |
| InChIKey | RJRFTIAUJCQDFV-UTGUJQJDSA-N |
| XLogP | -1.74 |
| TPSA | 174.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |