About N-methyl-N-[(1E)-penta-1,4-dienyl]butanamide
N-methyl-N-[(1E)-penta-1,4-dienyl]butanamide (PubChem CID 166629598) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is N-methyl-N-[(1E)-penta-1,4-dienyl]butanamide.
Molecular Properties
| Compound Name | N-methyl-N-[(1E)-penta-1,4-dienyl]butanamide |
| PubChem CID | 166629598 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | N-methyl-N-[(1E)-penta-1,4-dienyl]butanamide |
| SMILES | C=CC/C=C/N(C)C(=O)CCC |
| InChI | InChI=1S/C10H17NO/c1-4-6-7-9-11(3)10(12)8-5-2/h4,7,9H,1,5-6,8H2,2-3H3/b9-7+ |
| InChIKey | FIAYHFQASMTKCA-VQHVLOKHSA-N |
| XLogP | 2.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-[(1E)-penta-1,4-dienyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(1E)-penta-1,4-dienyl]butanamide?
The IUPAC name of N-methyl-N-[(1E)-penta-1,4-dienyl]butanamide (CID 166629598) is N-methyl-N-[(1E)-penta-1,4-dienyl]butanamide.
What is the SMILES notation for N-methyl-N-[(1E)-penta-1,4-dienyl]butanamide?
The canonical SMILES for N-methyl-N-[(1E)-penta-1,4-dienyl]butanamide is C=CC/C=C/N(C)C(=O)CCC.
What is the InChIKey of N-methyl-N-[(1E)-penta-1,4-dienyl]butanamide?
The InChIKey is FIAYHFQASMTKCA-VQHVLOKHSA-N. The full InChI is InChI=1S/C10H17NO/c1-4-6-7-9-11(3)10(12)8-5-2/h4,7,9H,1,5-6,8H2,2-3H3/b9-7+.
What are the key properties of N-methyl-N-[(1E)-penta-1,4-dienyl]butanamide?
N-methyl-N-[(1E)-penta-1,4-dienyl]butanamide has a molecular weight of 167.25 g/mol, XLogP of 2.33, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(1E)-penta-1,4-dienyl]butanamide is sourced from PubChem (CID 166629598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).