About 4-[[[(E)-3-(2,6-dimethylphenyl)prop-2-enoyl]amino]methyl]benzoic acid
4-[[[(E)-3-(2,6-dimethylphenyl)prop-2-enoyl]amino]methyl]benzoic acid (PubChem CID 166629700) has the molecular formula C19H19NO3
and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-[[[(E)-3-(2,6-dimethylphenyl)prop-2-enoyl]amino]methyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[[[(E)-3-(2,6-dimethylphenyl)prop-2-enoyl]amino]methyl]benzoic acid |
| PubChem CID | 166629700 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 4-[[[(E)-3-(2,6-dimethylphenyl)prop-2-enoyl]amino]methyl]benzoic acid |
| SMILES | Cc1cccc(C)c1/C=C/C(=O)NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H19NO3/c1-13-4-3-5-14(2)17(13)10-11-18(21)20-12-15-6-8-16(9-7-15)19(22)23/h3-11H,12H2,1-2H3,(H,20,21)(H,22,23)/b11-10+ |
| InChIKey | WASGSEPULUCVBF-ZHACJKMWSA-N |
| XLogP | 3.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[[[(E)-3-(2,6-dimethylphenyl)prop-2-enoyl]amino]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[[(E)-3-(2,6-dimethylphenyl)prop-2-enoyl]amino]methyl]benzoic acid?
The IUPAC name of 4-[[[(E)-3-(2,6-dimethylphenyl)prop-2-enoyl]amino]methyl]benzoic acid (CID 166629700) is 4-[[[(E)-3-(2,6-dimethylphenyl)prop-2-enoyl]amino]methyl]benzoic acid.
What is the SMILES notation for 4-[[[(E)-3-(2,6-dimethylphenyl)prop-2-enoyl]amino]methyl]benzoic acid?
The canonical SMILES for 4-[[[(E)-3-(2,6-dimethylphenyl)prop-2-enoyl]amino]methyl]benzoic acid is Cc1cccc(C)c1/C=C/C(=O)NCc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[[[(E)-3-(2,6-dimethylphenyl)prop-2-enoyl]amino]methyl]benzoic acid?
The InChIKey is WASGSEPULUCVBF-ZHACJKMWSA-N. The full InChI is InChI=1S/C19H19NO3/c1-13-4-3-5-14(2)17(13)10-11-18(21)20-12-15-6-8-16(9-7-15)19(22)23/h3-11H,12H2,1-2H3,(H,20,21)(H,22,23)/b11-10+.
What are the key properties of 4-[[[(E)-3-(2,6-dimethylphenyl)prop-2-enoyl]amino]methyl]benzoic acid?
4-[[[(E)-3-(2,6-dimethylphenyl)prop-2-enoyl]amino]methyl]benzoic acid has a molecular weight of 309.37 g/mol, XLogP of 3.33, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[[(E)-3-(2,6-dimethylphenyl)prop-2-enoyl]amino]methyl]benzoic acid is sourced from PubChem (CID 166629700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).