About [1-ethyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-2-yl]methanol
[1-ethyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-2-yl]methanol (PubChem CID 166629762) has the molecular formula C22H25NO4
and a molecular weight of 367.45 g/mol. Its IUPAC name is [1-ethyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-2-yl]methanol.
Molecular Properties
| Compound Name | [1-ethyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-2-yl]methanol |
| PubChem CID | 166629762 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | [1-ethyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-2-yl]methanol |
| SMILES | C=C(c1cc(OC)c(OC)c(OC)c1)c1ccc2c(c1)cc(CO)n2CC |
| InChI | InChI=1S/C22H25NO4/c1-6-23-18(13-24)10-17-9-15(7-8-19(17)23)14(2)16-11-20(25-3)22(27-5)21(12-16)26-4/h7-12,24H,2,6,13H2,1,3-5H3 |
| InChIKey | PPSQAHKAJPMVKE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 52.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-ethyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-ethyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-2-yl]methanol?
The IUPAC name of [1-ethyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-2-yl]methanol (CID 166629762) is [1-ethyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-2-yl]methanol.
What is the SMILES notation for [1-ethyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-2-yl]methanol?
The canonical SMILES for [1-ethyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-2-yl]methanol is C=C(c1cc(OC)c(OC)c(OC)c1)c1ccc2c(c1)cc(CO)n2CC.
What is the InChIKey of [1-ethyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-2-yl]methanol?
The InChIKey is PPSQAHKAJPMVKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25NO4/c1-6-23-18(13-24)10-17-9-15(7-8-19(17)23)14(2)16-11-20(25-3)22(27-5)21(12-16)26-4/h7-12,24H,2,6,13H2,1,3-5H3.
What are the key properties of [1-ethyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-2-yl]methanol?
[1-ethyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-2-yl]methanol has a molecular weight of 367.45 g/mol, XLogP of 4.24, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-ethyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-2-yl]methanol is sourced from PubChem (CID 166629762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).