C19H19BF2I3N3 — CID 166629780
2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-8-(1-methylpyridin-1-ium-3-yl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene iodide (PubChem CID 166629780) has the molecular formula C19H19BF2I3N3 and a molecular weight of 718.90 g/mol. Its IUPAC name is 2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-8-(1-methylpyridin-1-ium-3-yl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene iodide.
| Compound Name | 2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-8-(1-methylpyridin-1-ium-3-yl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene iodide |
|---|---|
| PubChem CID | 166629780 |
| Molecular Formula | C19H19BF2I3N3 |
| Molecular Weight | 718.90 g/mol |
| Exact Mass | 718.88 |
| IUPAC Name | 2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-8-(1-methylpyridin-1-ium-3-yl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene iodide |
| SMILES | CC1=C(I)C(C)=[N+]2C1=C(c1ccc[n+](C)c1)c1c(C)c(I)c(C)n1[B-]2(F)F.[I-] |
| InChI | InChI=1S/C19H19BF2I2N3.HI/c1-10-16(23)12(3)26-18(10)15(14-7-6-8-25(5)9-14)19-11(2)17(24)13(4)27(19)20(26,21)22;/h6-9H,1-5H3;1H/q+1;/p-1 |
| InChIKey | MYERULQSLGSRFP-UHFFFAOYSA-M |
| XLogP | 1.73 |
| TPSA | 11.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.90 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|