About 1-[4-[2-[(6,7-difluoroquinazolin-4-yl)amino]ethyl]phenyl]-3-phenylurea
1-[4-[2-[(6,7-difluoroquinazolin-4-yl)amino]ethyl]phenyl]-3-phenylurea (PubChem CID 166629806) has the molecular formula C23H19F2N5O
and a molecular weight of 419.44 g/mol. Its IUPAC name is 1-[4-[2-[(6,7-difluoroquinazolin-4-yl)amino]ethyl]phenyl]-3-phenylurea.
Molecular Properties
| Compound Name | 1-[4-[2-[(6,7-difluoroquinazolin-4-yl)amino]ethyl]phenyl]-3-phenylurea |
| PubChem CID | 166629806 |
| Molecular Formula | C23H19F2N5O |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 1-[4-[2-[(6,7-difluoroquinazolin-4-yl)amino]ethyl]phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(CCNc2ncnc3cc(F)c(F)cc23)cc1 |
| InChI | InChI=1S/C23H19F2N5O/c24-19-12-18-21(13-20(19)25)27-14-28-22(18)26-11-10-15-6-8-17(9-7-15)30-23(31)29-16-4-2-1-3-5-16/h1-9,12-14H,10-11H2,(H,26,27,28)(H2,29,30,31) |
| InChIKey | DGCIJDABQSMRMU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-[2-[(6,7-difluoroquinazolin-4-yl)amino]ethyl]phenyl]-3-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[2-[(6,7-difluoroquinazolin-4-yl)amino]ethyl]phenyl]-3-phenylurea?
The IUPAC name of 1-[4-[2-[(6,7-difluoroquinazolin-4-yl)amino]ethyl]phenyl]-3-phenylurea (CID 166629806) is 1-[4-[2-[(6,7-difluoroquinazolin-4-yl)amino]ethyl]phenyl]-3-phenylurea.
What is the SMILES notation for 1-[4-[2-[(6,7-difluoroquinazolin-4-yl)amino]ethyl]phenyl]-3-phenylurea?
The canonical SMILES for 1-[4-[2-[(6,7-difluoroquinazolin-4-yl)amino]ethyl]phenyl]-3-phenylurea is O=C(Nc1ccccc1)Nc1ccc(CCNc2ncnc3cc(F)c(F)cc23)cc1.
What is the InChIKey of 1-[4-[2-[(6,7-difluoroquinazolin-4-yl)amino]ethyl]phenyl]-3-phenylurea?
The InChIKey is DGCIJDABQSMRMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19F2N5O/c24-19-12-18-21(13-20(19)25)27-14-28-22(18)26-11-10-15-6-8-17(9-7-15)30-23(31)29-16-4-2-1-3-5-16/h1-9,12-14H,10-11H2,(H,26,27,28)(H2,29,30,31).
What are the key properties of 1-[4-[2-[(6,7-difluoroquinazolin-4-yl)amino]ethyl]phenyl]-3-phenylurea?
1-[4-[2-[(6,7-difluoroquinazolin-4-yl)amino]ethyl]phenyl]-3-phenylurea has a molecular weight of 419.44 g/mol, XLogP of 5.21, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[2-[(6,7-difluoroquinazolin-4-yl)amino]ethyl]phenyl]-3-phenylurea is sourced from PubChem (CID 166629806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).