About 3-(2,2-dipyridin-3-ylethyl)-N-[4-(trifluoromethoxy)phenyl]pyridin-2-amine
3-(2,2-dipyridin-3-ylethyl)-N-[4-(trifluoromethoxy)phenyl]pyridin-2-amine (PubChem CID 16662984) has the molecular formula C24H19F3N4O
and a molecular weight of 436.44 g/mol. Its IUPAC name is 3-(2,2-dipyridin-3-ylethyl)-N-[4-(trifluoromethoxy)phenyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 3-(2,2-dipyridin-3-ylethyl)-N-[4-(trifluoromethoxy)phenyl]pyridin-2-amine |
| PubChem CID | 16662984 |
| Molecular Formula | C24H19F3N4O |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 3-(2,2-dipyridin-3-ylethyl)-N-[4-(trifluoromethoxy)phenyl]pyridin-2-amine |
| SMILES | FC(F)(F)Oc1ccc(Nc2ncccc2CC(c2cccnc2)c2cccnc2)cc1 |
| InChI | InChI=1S/C24H19F3N4O/c25-24(26,27)32-21-9-7-20(8-10-21)31-23-17(4-3-13-30-23)14-22(18-5-1-11-28-15-18)19-6-2-12-29-16-19/h1-13,15-16,22H,14H2,(H,30,31) |
| InChIKey | RDMCNSGLOAAJFC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2,2-dipyridin-3-ylethyl)-N-[4-(trifluoromethoxy)phenyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dipyridin-3-ylethyl)-N-[4-(trifluoromethoxy)phenyl]pyridin-2-amine?
The IUPAC name of 3-(2,2-dipyridin-3-ylethyl)-N-[4-(trifluoromethoxy)phenyl]pyridin-2-amine (CID 16662984) is 3-(2,2-dipyridin-3-ylethyl)-N-[4-(trifluoromethoxy)phenyl]pyridin-2-amine.
What is the SMILES notation for 3-(2,2-dipyridin-3-ylethyl)-N-[4-(trifluoromethoxy)phenyl]pyridin-2-amine?
The canonical SMILES for 3-(2,2-dipyridin-3-ylethyl)-N-[4-(trifluoromethoxy)phenyl]pyridin-2-amine is FC(F)(F)Oc1ccc(Nc2ncccc2CC(c2cccnc2)c2cccnc2)cc1.
What is the InChIKey of 3-(2,2-dipyridin-3-ylethyl)-N-[4-(trifluoromethoxy)phenyl]pyridin-2-amine?
The InChIKey is RDMCNSGLOAAJFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19F3N4O/c25-24(26,27)32-21-9-7-20(8-10-21)31-23-17(4-3-13-30-23)14-22(18-5-1-11-28-15-18)19-6-2-12-29-16-19/h1-13,15-16,22H,14H2,(H,30,31).
What are the key properties of 3-(2,2-dipyridin-3-ylethyl)-N-[4-(trifluoromethoxy)phenyl]pyridin-2-amine?
3-(2,2-dipyridin-3-ylethyl)-N-[4-(trifluoromethoxy)phenyl]pyridin-2-amine has a molecular weight of 436.44 g/mol, XLogP of 5.89, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dipyridin-3-ylethyl)-N-[4-(trifluoromethoxy)phenyl]pyridin-2-amine is sourced from PubChem (CID 16662984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).