C24H34O5 — CID 166630121
[(2R,4R,8R,9S,13R)-2-ethoxy-5,5,9-trimethyl-14-methylidene-10,15-dioxo-8-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] acetate (PubChem CID 166630121) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is [(2R,4R,8R,9S,13R)-2-ethoxy-5,5,9-trimethyl-14-methylidene-10,15-dioxo-8-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] acetate.
| Compound Name | [(2R,4R,8R,9S,13R)-2-ethoxy-5,5,9-trimethyl-14-methylidene-10,15-dioxo-8-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] acetate |
|---|---|
| PubChem CID | 166630121 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | [(2R,4R,8R,9S,13R)-2-ethoxy-5,5,9-trimethyl-14-methylidene-10,15-dioxo-8-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] acetate |
| SMILES | C=C1C(=O)C2=C[C@H]1CCC(=O)[C@@]1(C)[C@H](C[C@H]2OCC)C(C)(C)CC[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H34O5/c1-7-28-18-13-19-23(4,5)11-10-21(29-15(3)25)24(19,6)20(26)9-8-16-12-17(18)22(27)14(16)2/h12,16,18-19,21H,2,7-11,13H2,1,3-6H3/t16-,18-,19-,21-,24-/m1/s1 |
| InChIKey | GLQLGNFCNWUZJL-KXWXAMNASA-N |
| XLogP | 4.20 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|