C22H30N6O — CID 166630195
4-N-butyl-6-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]pyrido[3,2-d]pyrimidine-2,4-diamine (PubChem CID 166630195) has the molecular formula C22H30N6O and a molecular weight of 394.52 g/mol. Its IUPAC name is 4-N-butyl-6-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]pyrido[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-6-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]pyrido[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 166630195 |
| Molecular Formula | C22H30N6O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 4-N-butyl-6-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]pyrido[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(N)nc2ccc(Cc3ccc(OCCN(C)C)cc3)nc12 |
| InChI | InChI=1S/C22H30N6O/c1-4-5-12-24-21-20-19(26-22(23)27-21)11-8-17(25-20)15-16-6-9-18(10-7-16)29-14-13-28(2)3/h6-11H,4-5,12-15H2,1-3H3,(H3,23,24,26,27) |
| InChIKey | XNCCIRRTYYOWQM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|