C28H36N4O3 — CID 166630268
[5-methyl-8-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-(4-propan-2-yloxycyclohexyl)methanone (PubChem CID 166630268) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is [5-methyl-8-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-(4-propan-2-yloxycyclohexyl)methanone.
| Compound Name | [5-methyl-8-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-(4-propan-2-yloxycyclohexyl)methanone |
|---|---|
| PubChem CID | 166630268 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | [5-methyl-8-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-(4-propan-2-yloxycyclohexyl)methanone |
| SMILES | CC(C)OC1CCC(C(=O)N2c3cc(N4C[C@@H]5C[C@H]4CO5)ccc3Nc3ncccc3C2C)CC1 |
| InChI | InChI=1S/C28H36N4O3/c1-17(2)35-22-9-6-19(7-10-22)28(33)32-18(3)24-5-4-12-29-27(24)30-25-11-8-20(14-26(25)32)31-15-23-13-21(31)16-34-23/h4-5,8,11-12,14,17-19,21-23H,6-7,9-10,13,15-16H2,1-3H3,(H,29,30)/t18?,19?,21-,22?,23-/m0/s1 |
| InChIKey | NSTOLUBLPHCKFS-DLPPYOOPSA-N |
| XLogP | 5.19 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |