C24H27F2NO3 — CID 166630295
7-[[3-[[4,4-difluorobutyl(methyl)amino]methyl]phenyl]methoxy]-3,4-dimethylchromen-2-one (PubChem CID 166630295) has the molecular formula C24H27F2NO3 and a molecular weight of 415.48 g/mol. Its IUPAC name is 7-[[3-[[4,4-difluorobutyl(methyl)amino]methyl]phenyl]methoxy]-3,4-dimethylchromen-2-one.
| Compound Name | 7-[[3-[[4,4-difluorobutyl(methyl)amino]methyl]phenyl]methoxy]-3,4-dimethylchromen-2-one |
|---|---|
| PubChem CID | 166630295 |
| Molecular Formula | C24H27F2NO3 |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 7-[[3-[[4,4-difluorobutyl(methyl)amino]methyl]phenyl]methoxy]-3,4-dimethylchromen-2-one |
| SMILES | Cc1c(C)c2ccc(OCc3cccc(CN(C)CCCC(F)F)c3)cc2oc1=O |
| InChI | InChI=1S/C24H27F2NO3/c1-16-17(2)24(28)30-22-13-20(9-10-21(16)22)29-15-19-7-4-6-18(12-19)14-27(3)11-5-8-23(25)26/h4,6-7,9-10,12-13,23H,5,8,11,14-15H2,1-3H3 |
| InChIKey | JFBYGVYECDFTLS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|