C26H29F4N3 — CID 166630341
(1R,3R)-1-[2,6-difluoro-4-[3-(fluoromethyl)azetidin-1-yl]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 166630341) has the molecular formula C26H29F4N3 and a molecular weight of 459.53 g/mol. Its IUPAC name is (1R,3R)-1-[2,6-difluoro-4-[3-(fluoromethyl)azetidin-1-yl]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-[2,6-difluoro-4-[3-(fluoromethyl)azetidin-1-yl]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 166630341 |
| Molecular Formula | C26H29F4N3 |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | (1R,3R)-1-[2,6-difluoro-4-[3-(fluoromethyl)azetidin-1-yl]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(N3CC(CF)C3)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C26H29F4N3/c1-15-8-19-18-6-4-5-7-22(18)31-24(19)25(33(15)14-26(2,3)30)23-20(28)9-17(10-21(23)29)32-12-16(11-27)13-32/h4-7,9-10,15-16,25,31H,8,11-14H2,1-3H3/t15-,25-/m1/s1 |
| InChIKey | PQLNPBZOUBHAHI-SGANQWHYSA-N |
| XLogP | 5.94 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|