About N-[2-(3,4-dichlorophenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide
N-[2-(3,4-dichlorophenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide (PubChem CID 166630413) has the molecular formula C19H12Cl2F3NO5S2
and a molecular weight of 526.34 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-[2-(3,4-dichlorophenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide |
| PubChem CID | 166630413 |
| Molecular Formula | C19H12Cl2F3NO5S2 |
| Molecular Weight | 526.34 g/mol |
| Exact Mass | 524.95 |
| IUPAC Name | N-[2-(3,4-dichlorophenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(S(=O)(=O)C(F)(F)F)cc1Oc1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C19H12Cl2F3NO5S2/c20-15-8-6-12(10-16(15)21)30-18-11-14(31(26,27)19(22,23)24)7-9-17(18)25-32(28,29)13-4-2-1-3-5-13/h1-11,25H |
| InChIKey | WXUTUFUBQRCRIA-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.34 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(3,4-dichlorophenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dichlorophenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide?
The IUPAC name of N-[2-(3,4-dichlorophenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide (CID 166630413) is N-[2-(3,4-dichlorophenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide.
What is the SMILES notation for N-[2-(3,4-dichlorophenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide?
The canonical SMILES for N-[2-(3,4-dichlorophenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide is O=S(=O)(Nc1ccc(S(=O)(=O)C(F)(F)F)cc1Oc1ccc(Cl)c(Cl)c1)c1ccccc1.
What is the InChIKey of N-[2-(3,4-dichlorophenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide?
The InChIKey is WXUTUFUBQRCRIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12Cl2F3NO5S2/c20-15-8-6-12(10-16(15)21)30-18-11-14(31(26,27)19(22,23)24)7-9-17(18)25-32(28,29)13-4-2-1-3-5-13/h1-11,25H.
What are the key properties of N-[2-(3,4-dichlorophenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide?
N-[2-(3,4-dichlorophenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide has a molecular weight of 526.34 g/mol, XLogP of 5.88, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dichlorophenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide is sourced from PubChem (CID 166630413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).