About N-[2-(3,5-dimethylphenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide
N-[2-(3,5-dimethylphenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide (PubChem CID 166630449) has the molecular formula C21H18F3NO5S2
and a molecular weight of 485.51 g/mol. Its IUPAC name is N-[2-(3,5-dimethylphenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-[2-(3,5-dimethylphenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide |
| PubChem CID | 166630449 |
| Molecular Formula | C21H18F3NO5S2 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | N-[2-(3,5-dimethylphenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide |
| SMILES | Cc1cc(C)cc(Oc2cc(S(=O)(=O)C(F)(F)F)ccc2NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C21H18F3NO5S2/c1-14-10-15(2)12-16(11-14)30-20-13-18(31(26,27)21(22,23)24)8-9-19(20)25-32(28,29)17-6-4-3-5-7-17/h3-13,25H,1-2H3 |
| InChIKey | ARWMGHTVYANHEH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(3,5-dimethylphenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,5-dimethylphenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide?
The IUPAC name of N-[2-(3,5-dimethylphenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide (CID 166630449) is N-[2-(3,5-dimethylphenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide.
What is the SMILES notation for N-[2-(3,5-dimethylphenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide?
The canonical SMILES for N-[2-(3,5-dimethylphenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide is Cc1cc(C)cc(Oc2cc(S(=O)(=O)C(F)(F)F)ccc2NS(=O)(=O)c2ccccc2)c1.
What is the InChIKey of N-[2-(3,5-dimethylphenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide?
The InChIKey is ARWMGHTVYANHEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F3NO5S2/c1-14-10-15(2)12-16(11-14)30-20-13-18(31(26,27)21(22,23)24)8-9-19(20)25-32(28,29)17-6-4-3-5-7-17/h3-13,25H,1-2H3.
What are the key properties of N-[2-(3,5-dimethylphenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide?
N-[2-(3,5-dimethylphenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide has a molecular weight of 485.51 g/mol, XLogP of 5.19, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,5-dimethylphenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide is sourced from PubChem (CID 166630449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).