C15H9FN4 — CID 166630484
5-(2-fluoro-3-pyridinyl)-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 166630484) has the molecular formula C15H9FN4 and a molecular weight of 264.26 g/mol. Its IUPAC name is 5-(2-fluoro-3-pyridinyl)-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 5-(2-fluoro-3-pyridinyl)-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 166630484 |
| Molecular Formula | C15H9FN4 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 5-(2-fluoro-3-pyridinyl)-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Fc1ncccc1-c1cnc2c(c1)[nH]c1ccncc12 |
| InChI | InChI=1S/C15H9FN4/c16-15-10(2-1-4-18-15)9-6-13-14(19-7-9)11-8-17-5-3-12(11)20-13/h1-8,20H |
| InChIKey | WRHATIIPPJXNIK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|