C30H35ClN8O3 — CID 166630490
2-[[5-chloro-2-[4-[4-[5-(prop-2-enoylamino)pentanoyl]piperazin-1-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide (PubChem CID 166630490) has the molecular formula C30H35ClN8O3 and a molecular weight of 591.12 g/mol. Its IUPAC name is 2-[[5-chloro-2-[4-[4-[5-(prop-2-enoylamino)pentanoyl]piperazin-1-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide.
| Compound Name | 2-[[5-chloro-2-[4-[4-[5-(prop-2-enoylamino)pentanoyl]piperazin-1-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 166630490 |
| Molecular Formula | C30H35ClN8O3 |
| Molecular Weight | 591.12 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | 2-[[5-chloro-2-[4-[4-[5-(prop-2-enoylamino)pentanoyl]piperazin-1-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide |
| SMILES | C=CC(=O)NCCCCC(=O)N1CCN(c2ccc(Nc3ncc(Cl)c(Nc4ccccc4C(=O)NC)n3)cc2)CC1 |
| InChI | InChI=1S/C30H35ClN8O3/c1-3-26(40)33-15-7-6-10-27(41)39-18-16-38(17-19-39)22-13-11-21(12-14-22)35-30-34-20-24(31)28(37-30)36-25-9-5-4-8-23(25)29(42)32-2/h3-5,8-9,11-14,20H,1,6-7,10,15-19H2,2H3,(H,32,42)(H,33,40)(H2,34,35,36,37) |
| InChIKey | JQNUSLIVQYXQRA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 131.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.12 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|