C29H27F2N5O4 — CID 166630510
3-[3,5-difluoro-4-[[3-[5-methoxy-4-(2-methoxyanilino)pyrimidin-2-yl]indazol-1-yl]methyl]phenoxy]propan-1-ol (PubChem CID 166630510) has the molecular formula C29H27F2N5O4 and a molecular weight of 547.56 g/mol. Its IUPAC name is 3-[3,5-difluoro-4-[[3-[5-methoxy-4-(2-methoxyanilino)pyrimidin-2-yl]indazol-1-yl]methyl]phenoxy]propan-1-ol.
| Compound Name | 3-[3,5-difluoro-4-[[3-[5-methoxy-4-(2-methoxyanilino)pyrimidin-2-yl]indazol-1-yl]methyl]phenoxy]propan-1-ol |
|---|---|
| PubChem CID | 166630510 |
| Molecular Formula | C29H27F2N5O4 |
| Molecular Weight | 547.56 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | 3-[3,5-difluoro-4-[[3-[5-methoxy-4-(2-methoxyanilino)pyrimidin-2-yl]indazol-1-yl]methyl]phenoxy]propan-1-ol |
| SMILES | COc1ccccc1Nc1nc(-c2nn(Cc3c(F)cc(OCCCO)cc3F)c3ccccc23)ncc1OC |
| InChI | InChI=1S/C29H27F2N5O4/c1-38-25-11-6-4-9-23(25)33-28-26(39-2)16-32-29(34-28)27-19-8-3-5-10-24(19)36(35-27)17-20-21(30)14-18(15-22(20)31)40-13-7-12-37/h3-6,8-11,14-16,37H,7,12-13,17H2,1-2H3,(H,32,33,34) |
| InChIKey | PYAFWWXPXHSNDM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|