About 11-fluoro-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline
11-fluoro-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline (PubChem CID 166630519) has the molecular formula C30H31FN6
and a molecular weight of 494.62 g/mol. Its IUPAC name is 11-fluoro-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline.
Molecular Properties
| Compound Name | 11-fluoro-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline |
| PubChem CID | 166630519 |
| Molecular Formula | C30H31FN6 |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | 11-fluoro-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline |
| SMILES | CN1CCN(c2ccc3c(c2)c2cc(N4CCN(C)CC4)ccc2c2nc4cc(F)ccc4nc32)CC1 |
| InChI | InChI=1S/C30H31FN6/c1-34-9-13-36(14-10-34)21-4-6-23-25(18-21)26-19-22(37-15-11-35(2)12-16-37)5-7-24(26)30-29(23)32-27-8-3-20(31)17-28(27)33-30/h3-8,17-19H,9-16H2,1-2H3 |
| InChIKey | PVQFCLNFCWDJBL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 38.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 11-fluoro-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-fluoro-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline?
The IUPAC name of 11-fluoro-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline (CID 166630519) is 11-fluoro-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline.
What is the SMILES notation for 11-fluoro-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline?
The canonical SMILES for 11-fluoro-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline is CN1CCN(c2ccc3c(c2)c2cc(N4CCN(C)CC4)ccc2c2nc4cc(F)ccc4nc32)CC1.
What is the InChIKey of 11-fluoro-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline?
The InChIKey is PVQFCLNFCWDJBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H31FN6/c1-34-9-13-36(14-10-34)21-4-6-23-25(18-21)26-19-22(37-15-11-35(2)12-16-37)5-7-24(26)30-29(23)32-27-8-3-20(31)17-28(27)33-30/h3-8,17-19H,9-16H2,1-2H3.
What are the key properties of 11-fluoro-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline?
11-fluoro-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline has a molecular weight of 494.62 g/mol, XLogP of 4.73, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 11-fluoro-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline is sourced from PubChem (CID 166630519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).