C27H37N5O3 — CID 166630626
2-[4-[4-(2-amino-4-pyridinyl)butoxy]-3-methoxyphenyl]-2-methyl-N-[3-(5-methylimidazol-1-yl)propyl]propanamide (PubChem CID 166630626) has the molecular formula C27H37N5O3 and a molecular weight of 479.63 g/mol. Its IUPAC name is 2-[4-[4-(2-amino-4-pyridinyl)butoxy]-3-methoxyphenyl]-2-methyl-N-[3-(5-methylimidazol-1-yl)propyl]propanamide.
| Compound Name | 2-[4-[4-(2-amino-4-pyridinyl)butoxy]-3-methoxyphenyl]-2-methyl-N-[3-(5-methylimidazol-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 166630626 |
| Molecular Formula | C27H37N5O3 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | 2-[4-[4-(2-amino-4-pyridinyl)butoxy]-3-methoxyphenyl]-2-methyl-N-[3-(5-methylimidazol-1-yl)propyl]propanamide |
| SMILES | COc1cc(C(C)(C)C(=O)NCCCn2cncc2C)ccc1OCCCCc1ccnc(N)c1 |
| InChI | InChI=1S/C27H37N5O3/c1-20-18-29-19-32(20)14-7-12-31-26(33)27(2,3)22-9-10-23(24(17-22)34-4)35-15-6-5-8-21-11-13-30-25(28)16-21/h9-11,13,16-19H,5-8,12,14-15H2,1-4H3,(H2,28,30)(H,31,33) |
| InChIKey | BVFYMVJVHSCTKR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|