C25H26F7N7O — CID 166630644
(E)-1-[4-[5-[4-amino-3-[3-fluoro-5-(trifluoromethyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]-4,4,4-trifluorobut-2-en-1-one (PubChem CID 166630644) has the molecular formula C25H26F7N7O and a molecular weight of 573.52 g/mol. Its IUPAC name is (E)-1-[4-[5-[4-amino-3-[3-fluoro-5-(trifluoromethyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]-4,4,4-trifluorobut-2-en-1-one.
| Compound Name | (E)-1-[4-[5-[4-amino-3-[3-fluoro-5-(trifluoromethyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]-4,4,4-trifluorobut-2-en-1-one |
|---|---|
| PubChem CID | 166630644 |
| Molecular Formula | C25H26F7N7O |
| Molecular Weight | 573.52 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | (E)-1-[4-[5-[4-amino-3-[3-fluoro-5-(trifluoromethyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]-4,4,4-trifluorobut-2-en-1-one |
| SMILES | Nc1ncnc2c1c(-c1cc(F)cc(C(F)(F)F)c1)nn2CCCCCN1CCN(C(=O)/C=C/C(F)(F)F)CC1 |
| InChI | InChI=1S/C25H26F7N7O/c26-18-13-16(12-17(14-18)25(30,31)32)21-20-22(33)34-15-35-23(20)39(36-21)7-3-1-2-6-37-8-10-38(11-9-37)19(40)4-5-24(27,28)29/h4-5,12-15H,1-3,6-11H2,(H2,33,34,35)/b5-4+ |
| InChIKey | FAJMNJHLDPNTLS-SNAWJCMRSA-N |
| XLogP | 4.67 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|