C25H33N7O3 — CID 166630682
1-[4-[5-[4-amino-3-(2,5-dimethoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 166630682) has the molecular formula C25H33N7O3 and a molecular weight of 479.59 g/mol. Its IUPAC name is 1-[4-[5-[4-amino-3-(2,5-dimethoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[5-[4-amino-3-(2,5-dimethoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166630682 |
| Molecular Formula | C25H33N7O3 |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 1-[4-[5-[4-amino-3-(2,5-dimethoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(CCCCCn2nc(-c3cc(OC)ccc3OC)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C25H33N7O3/c1-4-21(33)31-14-12-30(13-15-31)10-6-5-7-11-32-25-22(24(26)27-17-28-25)23(29-32)19-16-18(34-2)8-9-20(19)35-3/h4,8-9,16-17H,1,5-7,10-15H2,2-3H3,(H2,26,27,28) |
| InChIKey | DDTIUWSUHLYLSE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|