About 3,5-diethyl-4-[(N'-ethylcarbamimidoyl)carbamoylamino]benzoic acid
3,5-diethyl-4-[(N'-ethylcarbamimidoyl)carbamoylamino]benzoic acid (PubChem CID 166630945) has the molecular formula C15H22N4O3
and a molecular weight of 306.37 g/mol. Its IUPAC name is 3,5-diethyl-4-[(N'-ethylcarbamimidoyl)carbamoylamino]benzoic acid.
Molecular Properties
| Compound Name | 3,5-diethyl-4-[(N'-ethylcarbamimidoyl)carbamoylamino]benzoic acid |
| PubChem CID | 166630945 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 3,5-diethyl-4-[(N'-ethylcarbamimidoyl)carbamoylamino]benzoic acid |
| SMILES | CC/N=C(\N)NC(=O)Nc1c(CC)cc(C(=O)O)cc1CC |
| InChI | InChI=1S/C15H22N4O3/c1-4-9-7-11(13(20)21)8-10(5-2)12(9)18-15(22)19-14(16)17-6-3/h7-8H,4-6H2,1-3H3,(H,20,21)(H4,16,17,18,19,22) |
| InChIKey | JRRHXKAYWDCICC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diethyl-4-[(N'-ethylcarbamimidoyl)carbamoylamino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diethyl-4-[(N'-ethylcarbamimidoyl)carbamoylamino]benzoic acid?
The IUPAC name of 3,5-diethyl-4-[(N'-ethylcarbamimidoyl)carbamoylamino]benzoic acid (CID 166630945) is 3,5-diethyl-4-[(N'-ethylcarbamimidoyl)carbamoylamino]benzoic acid.
What is the SMILES notation for 3,5-diethyl-4-[(N'-ethylcarbamimidoyl)carbamoylamino]benzoic acid?
The canonical SMILES for 3,5-diethyl-4-[(N'-ethylcarbamimidoyl)carbamoylamino]benzoic acid is CC/N=C(\N)NC(=O)Nc1c(CC)cc(C(=O)O)cc1CC.
What is the InChIKey of 3,5-diethyl-4-[(N'-ethylcarbamimidoyl)carbamoylamino]benzoic acid?
The InChIKey is JRRHXKAYWDCICC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4O3/c1-4-9-7-11(13(20)21)8-10(5-2)12(9)18-15(22)19-14(16)17-6-3/h7-8H,4-6H2,1-3H3,(H,20,21)(H4,16,17,18,19,22).
What are the key properties of 3,5-diethyl-4-[(N'-ethylcarbamimidoyl)carbamoylamino]benzoic acid?
3,5-diethyl-4-[(N'-ethylcarbamimidoyl)carbamoylamino]benzoic acid has a molecular weight of 306.37 g/mol, XLogP of 1.97, 5 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethyl-4-[(N'-ethylcarbamimidoyl)carbamoylamino]benzoic acid is sourced from PubChem (CID 166630945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).