C29H38N6O — CID 166630951
4-[4-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]-9-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,4,9-triazaspiro[5.5]undecan-2-one (PubChem CID 166630951) has the molecular formula C29H38N6O and a molecular weight of 486.66 g/mol. Its IUPAC name is 4-[4-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]-9-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,4,9-triazaspiro[5.5]undecan-2-one.
| Compound Name | 4-[4-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]-9-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,4,9-triazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 166630951 |
| Molecular Formula | C29H38N6O |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.31 |
| IUPAC Name | 4-[4-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]-9-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,4,9-triazaspiro[5.5]undecan-2-one |
| SMILES | CC1(C)CCN(Cc2ccc(N3CC(=O)NC4(CCN(c5ccnc6[nH]ccc56)CC4)C3)cc2)CC1 |
| InChI | InChI=1S/C29H38N6O/c1-28(2)9-15-33(16-10-28)19-22-3-5-23(6-4-22)35-20-26(36)32-29(21-35)11-17-34(18-12-29)25-8-14-31-27-24(25)7-13-30-27/h3-8,13-14H,9-12,15-21H2,1-2H3,(H,30,31)(H,32,36) |
| InChIKey | PIIPLBAYSZUVEO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 67.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|