C25H28N4O — CID 166631046
4-[4-(3-piperidin-1-ylpropoxy)phenyl]-5H-indeno[1,2-d]pyrimidin-2-amine (PubChem CID 166631046) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is 4-[4-(3-piperidin-1-ylpropoxy)phenyl]-5H-indeno[1,2-d]pyrimidin-2-amine.
| Compound Name | 4-[4-(3-piperidin-1-ylpropoxy)phenyl]-5H-indeno[1,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 166631046 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 4-[4-(3-piperidin-1-ylpropoxy)phenyl]-5H-indeno[1,2-d]pyrimidin-2-amine |
| SMILES | Nc1nc(-c2ccc(OCCCN3CCCCC3)cc2)c2c(n1)-c1ccccc1C2 |
| InChI | InChI=1S/C25H28N4O/c26-25-27-23(22-17-19-7-2-3-8-21(19)24(22)28-25)18-9-11-20(12-10-18)30-16-6-15-29-13-4-1-5-14-29/h2-3,7-12H,1,4-6,13-17H2,(H2,26,27,28) |
| InChIKey | QYDDQJVHZBTEMT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|