C36H68N4O2+2 — CID 166631158
3-acetamidopropyl-[4-[dimethyl-[3-[[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoyl]amino]propyl]azaniumyl]butyl]-dimethylazanium (PubChem CID 166631158) has the molecular formula C36H68N4O2+2 and a molecular weight of 588.97 g/mol. Its IUPAC name is 3-acetamidopropyl-[4-[dimethyl-[3-[[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoyl]amino]propyl]azaniumyl]butyl]-dimethylazanium.
| Compound Name | 3-acetamidopropyl-[4-[dimethyl-[3-[[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoyl]amino]propyl]azaniumyl]butyl]-dimethylazanium |
|---|---|
| PubChem CID | 166631158 |
| Molecular Formula | C36H68N4O2+2 |
| Molecular Weight | 588.97 g/mol |
| Exact Mass | 588.53 |
| IUPAC Name | 3-acetamidopropyl-[4-[dimethyl-[3-[[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoyl]amino]propyl]azaniumyl]butyl]-dimethylazanium |
| SMILES | CC(=O)NCCC[N+](C)(C)CCCC[N+](C)(C)CCCNC(=O)/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C36H66N4O2/c1-31(2)18-13-19-32(3)20-14-21-33(4)22-15-23-34(5)30-36(42)38-25-17-29-40(9,10)27-12-11-26-39(7,8)28-16-24-37-35(6)41/h18,20,22,30H,11-17,19,21,23-29H2,1-10H3/p+2/b32-20+,33-22+,34-30+ |
| InChIKey | UVSSTABXHOBGIS-SGULRMECSA-P |
| XLogP | 7.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.97 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|