About 4-(2,3-dihydro-1-benzofuran-5-yl)pyridine-2,6-diamine
4-(2,3-dihydro-1-benzofuran-5-yl)pyridine-2,6-diamine (PubChem CID 166631199) has the molecular formula C13H13N3O
and a molecular weight of 227.27 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzofuran-5-yl)pyridine-2,6-diamine.
Molecular Properties
| Compound Name | 4-(2,3-dihydro-1-benzofuran-5-yl)pyridine-2,6-diamine |
| PubChem CID | 166631199 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-(2,3-dihydro-1-benzofuran-5-yl)pyridine-2,6-diamine |
| SMILES | Nc1cc(-c2ccc3c(c2)CCO3)cc(N)n1 |
| InChI | InChI=1S/C13H13N3O/c14-12-6-10(7-13(15)16-12)8-1-2-11-9(5-8)3-4-17-11/h1-2,5-7H,3-4H2,(H4,14,15,16) |
| InChIKey | RVIBIVVELAQXPQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2,3-dihydro-1-benzofuran-5-yl)pyridine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dihydro-1-benzofuran-5-yl)pyridine-2,6-diamine?
The IUPAC name of 4-(2,3-dihydro-1-benzofuran-5-yl)pyridine-2,6-diamine (CID 166631199) is 4-(2,3-dihydro-1-benzofuran-5-yl)pyridine-2,6-diamine.
What is the SMILES notation for 4-(2,3-dihydro-1-benzofuran-5-yl)pyridine-2,6-diamine?
The canonical SMILES for 4-(2,3-dihydro-1-benzofuran-5-yl)pyridine-2,6-diamine is Nc1cc(-c2ccc3c(c2)CCO3)cc(N)n1.
What is the InChIKey of 4-(2,3-dihydro-1-benzofuran-5-yl)pyridine-2,6-diamine?
The InChIKey is RVIBIVVELAQXPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O/c14-12-6-10(7-13(15)16-12)8-1-2-11-9(5-8)3-4-17-11/h1-2,5-7H,3-4H2,(H4,14,15,16).
What are the key properties of 4-(2,3-dihydro-1-benzofuran-5-yl)pyridine-2,6-diamine?
4-(2,3-dihydro-1-benzofuran-5-yl)pyridine-2,6-diamine has a molecular weight of 227.27 g/mol, XLogP of 1.85, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydro-1-benzofuran-5-yl)pyridine-2,6-diamine is sourced from PubChem (CID 166631199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).