About N-methyl-1-[(7S)-7-methyl-4,5-dihydrothieno[2,3-c]pyran-7-yl]methanamine
N-methyl-1-[(7S)-7-methyl-4,5-dihydrothieno[2,3-c]pyran-7-yl]methanamine (PubChem CID 166631215) has the molecular formula C10H15NOS
and a molecular weight of 197.30 g/mol. Its IUPAC name is N-methyl-1-[(7S)-7-methyl-4,5-dihydrothieno[2,3-c]pyran-7-yl]methanamine.
Molecular Properties
| Compound Name | N-methyl-1-[(7S)-7-methyl-4,5-dihydrothieno[2,3-c]pyran-7-yl]methanamine |
| PubChem CID | 166631215 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | N-methyl-1-[(7S)-7-methyl-4,5-dihydrothieno[2,3-c]pyran-7-yl]methanamine |
| SMILES | CNC[C@]1(C)OCCc2ccsc21 |
| InChI | InChI=1S/C10H15NOS/c1-10(7-11-2)9-8(3-5-12-10)4-6-13-9/h4,6,11H,3,5,7H2,1-2H3/t10-/m0/s1 |
| InChIKey | KJOMHRUJAVDLSX-JTQLQIEISA-N |
| XLogP | 1.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-1-[(7S)-7-methyl-4,5-dihydrothieno[2,3-c]pyran-7-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[(7S)-7-methyl-4,5-dihydrothieno[2,3-c]pyran-7-yl]methanamine?
The IUPAC name of N-methyl-1-[(7S)-7-methyl-4,5-dihydrothieno[2,3-c]pyran-7-yl]methanamine (CID 166631215) is N-methyl-1-[(7S)-7-methyl-4,5-dihydrothieno[2,3-c]pyran-7-yl]methanamine.
What is the SMILES notation for N-methyl-1-[(7S)-7-methyl-4,5-dihydrothieno[2,3-c]pyran-7-yl]methanamine?
The canonical SMILES for N-methyl-1-[(7S)-7-methyl-4,5-dihydrothieno[2,3-c]pyran-7-yl]methanamine is CNC[C@]1(C)OCCc2ccsc21.
What is the InChIKey of N-methyl-1-[(7S)-7-methyl-4,5-dihydrothieno[2,3-c]pyran-7-yl]methanamine?
The InChIKey is KJOMHRUJAVDLSX-JTQLQIEISA-N. The full InChI is InChI=1S/C10H15NOS/c1-10(7-11-2)9-8(3-5-12-10)4-6-13-9/h4,6,11H,3,5,7H2,1-2H3/t10-/m0/s1.
What are the key properties of N-methyl-1-[(7S)-7-methyl-4,5-dihydrothieno[2,3-c]pyran-7-yl]methanamine?
N-methyl-1-[(7S)-7-methyl-4,5-dihydrothieno[2,3-c]pyran-7-yl]methanamine has a molecular weight of 197.30 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[(7S)-7-methyl-4,5-dihydrothieno[2,3-c]pyran-7-yl]methanamine is sourced from PubChem (CID 166631215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).