C17H20BrFN8O2 — CID 166631253
N'-(3-bromo-4-fluorophenyl)-4-[2-(4-tert-butyltriazol-1-yl)ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 166631253) has the molecular formula C17H20BrFN8O2 and a molecular weight of 467.30 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-4-[2-(4-tert-butyltriazol-1-yl)ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-4-[2-(4-tert-butyltriazol-1-yl)ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 166631253 |
| Molecular Formula | C17H20BrFN8O2 |
| Molecular Weight | 467.30 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-4-[2-(4-tert-butyltriazol-1-yl)ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CC(C)(C)c1cn(CCNc2nonc2/C(=N/c2ccc(F)c(Br)c2)NO)nn1 |
| InChI | InChI=1S/C17H20BrFN8O2/c1-17(2,3)13-9-27(26-22-13)7-6-20-15-14(24-29-25-15)16(23-28)21-10-4-5-12(19)11(18)8-10/h4-5,8-9,28H,6-7H2,1-3H3,(H,20,25)(H,21,23) |
| InChIKey | STBXVMPQYWHXKI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|